| PRRID_0181 | Peptidoglycan (PGN) Click for more detail | Gram-positive bacteria | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N | NA | Peptidoglycan | Natural | PGN is known to be a potent activator of NF-κB and TNF-α through TLR2 | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) | NOD-like receptor (NLR) | Human | HEK293T (human embryonic kidney 293T cells) | NA | Q9Y239.fasta | Q9Y239 | 953 | play key roles in regulation of innate immune response. NLRs can cooperate with Toll-like receptors and regulate inflammatory and apoptotic response. | NA | 12871942 | 2003 | Pubchem Assay | |