Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0221 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0221 |
| Ligand Name | FK565 |
| Source | NA |
| Sequence of ligand | CC(C)(C)OC(=O)CCC(C(=O)O)NC(=O)OC(C)(C)C |
| Length | NA |
| Type | Peptide |
| Occurence | Synthetic |
| Role of Ligand | It induces the secretion of the IL-8 |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Monocytes |
| Domain | NA |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | It leads to the maturation and activation of the host cells. |
| Assay used | ELISA |
| PMID | 15617523 |
| Year of Publication | 2005 |
| Pubchem assay | Pubchem Assay |
| Primary information | |
|---|---|
| PRRID | PRRID_0221 |
| Ligand Name | FK565 |
| Source | NA |
| Sequence of ligand | CC(C)(C)OC(=O)CCC(C(=O)O)NC(=O)OC(C)(C)C |
| Length | NA |
| Type | Peptide |
| Occurence | Synthetic |
| Role of Ligand | It induces the secretion of the IL-8 |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Monocytes |
| Domain | NA |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | It leads to the maturation and activation of the host cells. |
| Assay used | ELISA |
| PMID | 15617523 |
| Year of Publication | 2005 |
| Pubchem assay | Pubchem Assay |