Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0140 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0140 |
| Ligand Name | N-acetylmannosamine |
| Source | Bacteria |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)CO)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Endo180 |
| Type of receptor | Mannose receptor (MR) |
| Source | Human |
| Localization | NA |
| Domain | lectin-like domains |
| Sequence of Receptor | Q9UBG0.fasta |
| Swiss prot ID | Q9UBG0 |
| Length Of Receptor | 1479 |
| Function | NA |
| Assay used | Sugar-Binding assay |
| PMID | 12399458 |
| Year of Publication | 2002 |
| Pubchem assay | Pubchem Assay |
| Primary information | |
|---|---|
| PRRID | PRRID_0140 |
| Ligand Name | N-acetylmannosamine |
| Source | Bacteria |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)CO)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Endo180 |
| Type of receptor | Mannose receptor (MR) |
| Source | Human |
| Localization | NA |
| Domain | lectin-like domains |
| Sequence of Receptor | Q9UBG0.fasta |
| Swiss prot ID | Q9UBG0 |
| Length Of Receptor | 1479 |
| Function | NA |
| Assay used | Sugar-Binding assay |
| PMID | 12399458 |
| Year of Publication | 2002 |
| Pubchem assay | Pubchem Assay |