| Primary information |
|---|
| PRRID | PRRID_0226 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | PGN is known to be a potent activator of NF-κB and TNF-α through TLR2 |
| Name of receptor | Toll-like receptor 2 (TLR2)/Toll-like receptor 6 (TLR6) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | monocytic cell line |
| Domain | extracellular leucine-rich mo- tifs, and a cytoplasmic domain called the Toll/IL-1R homology domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | TLR2 is involved in the specific recognition of a wide range of ligands, either as a homodimer or as a heterodimer with TLR1 or TLR6. |
| Assay used | ELISA |
| PMID | 15661917 |
| Year of Publication | 2005 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0226 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | PGN is known to be a potent activator of NF-κB and TNF-α through TLR2 |
| Name of receptor | Toll-like receptor 2 (TLR2)/Toll-like receptor 6 (TLR6) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | monocytic cell line |
| Domain | extracellular leucine-rich mo- tifs, and a cytoplasmic domain called the Toll/IL-1R homology domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | TLR2 is involved in the specific recognition of a wide range of ligands, either as a homodimer or as a heterodimer with TLR1 or TLR6. |
| Assay used | ELISA |
| PMID | 15661917 |
| Year of Publication | 2005 |
| Pubchem assay | NA |