| Primary information |
|---|
| PRRID | PRRID_0156 |
| Ligand Name | 7-deazaguanosine (7-deazaG) |
| Source | Guanosine (others) |
| Sequence of ligand | C1=CN(C2=C1C(=O)N=C(N2)N)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces the production of type I IFNs, tumor necrosis factor alpha and IL-12 |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Peripheral blood leukocytes |
| Domain | LRR |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | It leads to the immunostimulatory by immune system. |
| Assay used | ELISA |
| PMID | 12738885 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0156 |
| Ligand Name | 7-deazaguanosine (7-deazaG) |
| Source | Guanosine (others) |
| Sequence of ligand | C1=CN(C2=C1C(=O)N=C(N2)N)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces the production of type I IFNs, tumor necrosis factor alpha and IL-12 |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Peripheral blood leukocytes |
| Domain | LRR |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | It leads to the immunostimulatory by immune system. |
| Assay used | ELISA |
| PMID | 12738885 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |