Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0181 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0181 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | PGN is known to be a potent activator of NF-κB and TNF-α through TLR2 |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | HEK293T (human embryonic kidney 293T cells) |
| Domain | NA |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | play key roles in regulation of innate immune response. NLRs can cooperate with Toll-like receptors and regulate inflammatory and apoptotic response. |
| Assay used | NA |
| PMID | 12871942 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |
| Primary information | |
|---|---|
| PRRID | PRRID_0181 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | PGN is known to be a potent activator of NF-κB and TNF-α through TLR2 |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | HEK293T (human embryonic kidney 293T cells) |
| Domain | NA |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | play key roles in regulation of innate immune response. NLRs can cooperate with Toll-like receptors and regulate inflammatory and apoptotic response. |
| Assay used | NA |
| PMID | 12871942 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |