| PRRID_0495 | endotoxin-free poly(I:C) Click for more detail | Bacteria | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O | NA | Nucleic Acid | Synthetic | It activates the TLR3-TRIF pathway, lead to the production of IL-5, IL-13 and CCL11 | Toll-like receptor 3 (TLR3) | Toll-like receptor (TLR) | C57BL/6 Mice (experimental model of lung allergic exacerbation) | Airway Epithilium and Dedritic cells | Leucine-rich Repeat (LRR) Domain | Q99MB1.fasta | Q99MB1 | 905 | It significantly increased the airway hyperresponsiveness, the lung inflammation | ELISA | 20505141 | 2010 | Pubchem Assay | |