| Primary information |
|---|
| PRRID | PRRID_0495 |
| Ligand Name | endotoxin-free poly(I:C) |
| Source | Bacteria |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It activates the TLR3-TRIF pathway, lead to the production of IL-5, IL-13 and CCL11 |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | C57BL/6 Mice (experimental model of lung allergic exacerbation) |
| Localization | Airway Epithilium and Dedritic cells |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q99MB1.fasta |
| Swiss prot ID | Q99MB1 |
| Length Of Receptor | 905 |
| Function | It significantly increased the airway hyperresponsiveness, the lung inflammation |
| Assay used | ELISA |
| PMID | 20505141 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0495 |
| Ligand Name | endotoxin-free poly(I:C) |
| Source | Bacteria |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It activates the TLR3-TRIF pathway, lead to the production of IL-5, IL-13 and CCL11 |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | C57BL/6 Mice (experimental model of lung allergic exacerbation) |
| Localization | Airway Epithilium and Dedritic cells |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q99MB1.fasta |
| Swiss prot ID | Q99MB1 |
| Length Of Receptor | 905 |
| Function | It significantly increased the airway hyperresponsiveness, the lung inflammation |
| Assay used | ELISA |
| PMID | 20505141 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |