A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1053 |
| PubChem ID | 5459840 |
| Hormone name | Ecdysterone |
| Description | A steroid hormone that regulates the processes of MOLTING or ecdysis in insects. Ecdysterone is the 20-hydroxylated ECDYSONE. |
| Synonyms | Ecdysterone beta-Ecdysone Polypodine A Crustecdysone Isoinokosterone Viticosterone Commisterone Crustecdyson Ecdysteron 20-HYDROXYECDYSONE |
| Molecular weight | 480.63 |
| Molecular formula | C27H44O7 |
| IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cycl openta[a]phenanthren-6-one |
| Canonical smiles | CC12CCC3C(=CC(=O)C4C3(CC(C(C4)O)O)C)C1(CCC2C(C)(C(CCC(C)(C)O)O)O)O |
| Isomeric smiles | C[C@]12CC[C@H]3C(=CC(=O)[C@H]4[C@@]3(C[C@@H]([C@@H](C4)O)O)C)[C@@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)O)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 2R40 |
| KEGG ID | C02633 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P17672 Detail in HMRbase P13055 Detail in HMRbase P17671 Detail in HMRbase O01639 Detail in HMRbase P50239 Detail in HMRbase Q08893 Detail in HMRbase P45447 Detail in HMRbase P49880 Detail in HMRbase P49881 Detail in HMRbase P49882 Detail in HMRbase P34021 Detail in HMRbase O18473 Detail in HMRbase O18531 Detail in HMRbase P49883 Detail in HMRbase |
| Comments | !Link to Receptor is not Organism Specific |
| References | Pubchem |