A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1353 |
PubChem ID | 5283127 |
Hormone name | LTB4 ethanol amide |
Description | |
Synonyms | LTB4 ethanol amide N-(2-hydroxyethyl)-5S,12R-dihydroxy-6Z,8E,10E,14Z-eicosatetraen-1-amide |
Molecular weight | 379.53 |
Molecular formula | C22H37NO4 |
IUPAC Name | (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxy-N-(2-hydroxyethyl)icosa-6,8,10,14-tetraenamide |
Canonical smiles | CCCCCC=CCC(C=CC=CC=CC(CCCC(=O)NCCO)O)O |
Isomeric smiles | CCCCCC=C/C[C@H](C=CC=CC=C/[C@H](CCCC(=O)NCCO)O)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | N/A |
HMDB ID | HMDB02304 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | Q15722 Detail in HMRbase Q9Y271 Detail in HMRbase Q9NPC1 Detail in HMRbase |
Comments | |
References | Endonet |