A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1301 |
| PubChem ID | 440567 |
| Hormone name | Taurocholic Acid |
| Description | The product of conjugation of cholic acid with taurine. Its sodium salt is the chief ingredient of the bile of carnivorous animals. It acts as a detergent to solubilize fats for absorption and is itself absorbed. It is used as a cholagogue and cholerectic. |
| Synonyms | Cholyltaurine Taurocholic Acid Taurocholate |
| Molecular weight | 515.7 |
| Molecular formula | C26H45NO7S |
| IUPAC Name | 2-[4-[(3R,5S,7R,12S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]eth anesulfonic acid |
| Canonical smiles | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C |
| Isomeric smiles | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C1([C@H](CC3C2[C@@H](C[C@H]4C3(CC[C@H](C4)O)C)O)O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C05122 |
| HMDB ID | HMDB00036 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q3SZL0 Detail in HMRbase Q96RI1 Detail in HMRbase Q60641 Detail in HMRbase Q62735 Detail in HMRbase Q811W9 Detail in HMRbase Q811X0 Detail in HMRbase Q811X1 Detail in HMRbase Q811X2 Detail in HMRbase Q8JHU2 Detail in HMRbase |
| Comments | !Link to Receptor is not Organism Specific |
| References | HMDB |