A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1237 |
| PubChem ID | 6438368 |
| Hormone name | 1,25-dihydroxyvitamin D3-26,23-lactone |
| Description | |
| Synonyms | 1,25-Lactone Calcitriol-26,23-lactone 1,25-dihydroxyvitaminD3-26,23-lactone 1,25-Dihydroxycholecalciferol-26-23-lactone 1alpha,25-Dihydroxyvitamin D3-26,23-lactone 23(S),25(R)-1,25(OH)2D3-26,23-Lactone (23S,25R)-1alpha,25-dihydroxyvitamin D3 26,23-lactone / (23S,25R)-1alpha,25-dihydroxycholecalciferol 26,23-lactone (5Z,7E)-(1S,3R,23S,25R)-1,3,25-trihydroxy-9,10-seco-5,7,10(19)-cho lestatrieno-26,23-lactone |
| Molecular weight | 444.6 |
| Molecular formula | C27H40O5 |
| IUPAC Name | (3R,5S)-5-[(2R)-2-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl ]propyl]-3-hydroxy-3-methyloxolan-2-one |
| Canonical smiles | CC(CC1CC(C(=O)O1)(C)O)C2CCC3C2(CCCC3=CC=C4CC(CC(C4=C)O)O)C |
| Isomeric smiles | C[C@H](C[C@H]1C[C@@](C(=O)O1)(C)O)[C@H]2CC[C@@H]3[C@@]2(CCC/C3=CC=C/4C[C@H](C[C@@H](C4=C)O)O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB00969 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q9PTN2 Detail in HMRbase Q1L673 Detail in HMRbase Q28037 Detail in HMRbase O42392 Detail in HMRbase P49701 Detail in HMRbase P11473 Detail in HMRbase P48281 Detail in HMRbase A3RGC1 Detail in HMRbase P13053 Detail in HMRbase Q95MH5 Detail in HMRbase O13124 Detail in HMRbase Q90WN9 Detail in HMRbase Q90WS4 Detail in HMRbase |
| Comments | !Link to Receptor is not Organism Specific |
| References | HMDB |