Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence RGD |
| Primary information | |
|---|---|
| SAPdb ID | 1167, |
| PMID | 22852757 |
| Peptide Name | Fmoc-RGD |
| Peptide sequence | RGD |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - Transmission Electron Microscopy (TEM) |
| Solvent | Water |
| Method | Fmoc-RGD and water were added to a vial to obtain a 10 wt % peptide suspension and pH 6.94 of the solution. The mixture was ultrasonicated for 15 min at 50 °C. The solution was stored at 5 °C for 15 h and then placed again in an ultrasonic bath at 50 °C for 10 min. The cooling‚à Ãheating/ultrasound process was repeated for 5 days until the sample became a homogeneous gel. |
| Conc | 10% wt |
| Temperature | 6.94 |
| Temperature | 50 °C (Heating) and 5 °C (Cooling) |
| Incubation Time | 5 days |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Hydogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable in water for nearly 40 days | |
| Hydrogel | |
| NA | |
| None | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1178, |
| PMID | 19705843 |
| Peptide Name | Fmoc-RGD |
| Peptide sequence | RGD |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Technique | Transmission Electron Microscopy (TEM), AFM (Atomic Force Microscopy) |
| Solvent | Water + DMSO |
| Method | Peptide first dissolved in DMSO at 25 -100mg/ml and then diluted in water to their final concentration 5mg/ml and form nanotube at room temperatur |
| Conc | 5mg/ml |
| Temperature | ~3 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| 15 | |
| None | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1647, |
| PMID | 29368775 |
| Peptide Name | arginine-glycine-aspartic acid |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | NMR |
| Solvent | chloroform (CDCl3) or deuterium oxide (D2O) |
| Conc | 1 g/L. |
| Temperature | 5.5 |
| Temperature | (-20°C) |
| Year | 2018 |
| Self assembly | No |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| NA | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1661, |
| PMID | 29573728 |
| Peptide Name | Polyamidoamine (PAMAM) |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | Scanning Electron Microscopy (SEM) |
| Solvent | PCL-CHIT polymer solutions |
| Conc | 2.0 mg mL-1 |
| Temperature | 7.4 |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanofiber |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| RGD | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1666, |
| PMID | 29776313 |
| Peptide Name | arginine-glycine-aspartic acid |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugate |
| Conjugate partner | Gly-Arg-Gly-Asp-Ser (GRGDS) |
| Technique | Fourier transform infrared (FTIR) spectroscopy |
| Solvent | EDC simultaneously with NHS |
| Conc | 0.025, 0.05, 0.1, 0.5, or 1.0 lg/m |
| Temperature | 8 |
| Temperature | Room temperature |
| Year | 2018 |
| Self assembly | NA |
| Type of Self assembly | nanoscaled coating |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1667, |
| PMID | 29776313 |
| Peptide Name | arginine-glycine-aspartic acid |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugate |
| Conjugate partner | Gly-Arg-Gly-Asp-Ser-Pro-Lys (GRGDSPK) |
| Technique | Fourier transform infrared (FTIR) spectroscopy |
| Solvent | EDC simultaneously with NHS |
| Conc | 0.5 mg mL−1 |
| Temperature | 8 |
| Temperature | Room temperature |
| Year | 2018 |
| Self assembly | NA |
| Type of Self assembly | nanoscaled coating |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1668, |
| PMID | 29776313 |
| Peptide Name | arginine-glycine-aspartic acid |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugate |
| Conjugate partner | cyclo(Arg-Gly-Asp-D-Tyr-Lys) (cRGDyK) |
| Technique | Fourier transform infrared (FTIR) spectroscopy |
| Solvent | EDC simultaneously with NHS |
| Conc | 50 mM HEPES pH 7.4, 150 mM NaCl, 5% glycerol, 1 mM EDTA, 0.5% (v/v) NP-40, 0.5% (v/v) CHAPS |
| Temperature | 8 |
| Temperature | Room temperature |
| Year | 2018 |
| Self assembly | NA |
| Type of Self assembly | nanoscaled coating |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| NA | |
| Other | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1692, |
| PMID | 30103136 |
| Peptide Name | arginine-glycine-aspartic acid |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugated |
| Conjugate partner | MNPs |
| Technique | Transmission Electron Microscopy (TEM) |
| Solvent | MNPs dispersed in water |
| Conc | mg/mL |
| Temperature | 6.3 |
| Temperature | Room temperature |
| Incubation Time | 1 hour |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| RGD | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1724, |
| PMID | 30413890 |
| Peptide Name | arginine-glycine-aspartic acid |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Solvent | conductor-like polarizable continuum model (CPCM) |
| Method | Studying the chemical reactivity properties of the target tumor-environment tripeptides NGR (asparagine-glycine-arginine) and RGD (arginine-glycine-aspartic acid) in their interactions with tamoxifen through conceptual density functional theory |
| Year | 2018 |
| Self assembly | No |
| Type of Self assembly | nanodiamonds |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1738, |
| PMID | 30641263 |
| Peptide Name | RGD-alginate |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | alginate |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Solvent | α-MEM |
| Conc | 2% (w/v) |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1739, |
| PMID | 30641263 |
| Peptide Name | RGD-hyaluronate |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | hyaluronate |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Solvent | α-MEM |
| Conc | 1% (w/v) |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1775, |
| PMID | 31152925 |
| Peptide Name | RGD-HZ-GMS |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugated |
| Conjugate partner | HZ-GMS |
| Technique | mass and 1H-NMR spectrum and infrared spectroscopy (IR) |
| Solvent | ethanol |
| Conc | 100ml |
| Temperature | Room temperature |
| Incubation Time | 48 h |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoparticle | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1776, |
| PMID | 31152925 |
| Peptide Name | RGD-DOX-SLNs |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugated |
| Conjugate partner | DOX-SLNs |
| Technique | fluorescence microscop |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoparticle | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1781, |
| PMID | 30127610 |
| Peptide Name | cRGD-conjugated F127 |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugated |
| Conjugate partner | F127 |
| Technique | confocal microscopy |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoparticle | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1791, |
| PMID | 30356964 |
| Peptide Name | PDA-CD-RGD |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugated |
| Conjugate partner | PDA-CD |
| Technique | TEM, UV/vis spectra, FT-IR |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanoparticle | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1795, |
| PMID | 30651772 |
| Peptide Name | Arg-Gly-Asp |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | scanning electron microscopy (SEM) and Fourier‑transform infrared spectroscopy. |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| 400 and 1,200 | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1837, |
| PMID | 27427416 |
| Peptide Name | arginine-glycine-aspartic acid |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM) |
| Solvent | Borate buffer |
| Conc | 0.02mol/l |
| Temperature | 8 |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Nanocrystals |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| NA | |
| Other | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1838, |
| PMID | 27497073 |
| Peptide Name | RGD/DTX- PSL |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | DTX |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Docetaxel |
| Technique | Transmission Electron Microscopy (TEM) |
| Solvent | PBS buffer |
| Method | Dynamic light scattering (DLS) |
| Conc | 0.01M |
| Temperature | 7.4 |
| Temperature | 50°C |
| Incubation Time | 50 min |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Liposomes |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| NA | |
| Other | |
| 146.4 | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1976, |
| PMID | 28787634 |
| Peptide Name | Arg-Gly- Asp (RGD) |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | circular dichroism (CD), UV absorption spectroscopy, cryogenic transmission electron microscopy (cryo-TEM), small angle X-ray scattering (SAXS) and static light scattering (SLS) |
| Solvent | sodium carbonate/bicarbonate buffers |
| Conc | 5.0 x 10-3 M |
| Temperature | 10 |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | long twisted ribbons |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| long twisted ribbons | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1977, |
| PMID | 28787634 |
| Peptide Name | N-3β-(4-t-Butylbenzoylamine)-(7α,12α-dihydroxy-5β-cholan-24- oyl)-(S)-arginine-(S)-glycine-(S)-a |
| Peptide sequence | RGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | tbutPhC |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | circular dichroism (CD), UV absorption spectroscopy, cryogenic transmission electron microscopy (cryo-TEM), small angle X-ray scattering (SAXS) and static light scattering (SLS) |
| Solvent | sodium carbonate/bicarbonate buffers |
| Conc | 5.0 x 10-3 M |
| Temperature | 10 |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | long twisted ribbons |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| long twisted ribbons | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |