Welcome to Entry Card of Peptide
Details of SAPdb ID 1977 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1977 | |
| PMID | 28787634 | |
| Year | 2017 | |
| Name | N-3β-(4-t-Butylbenzoylamine)-(7α,12α-dihydroxy-5β-cholan-24- oyl)-(S)-arginine-(S)-glycine-(S)-a | |
| Sequence | RGD | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | tbutPhC | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | circular dichroism (CD), UV absorption spectroscopy, cryogenic transmission electron microscopy (cryo-TEM), small angle X-ray scattering (SAXS) and static light scattering (SLS) | |
| Solvent | sodium carbonate/bicarbonate buffers | |
| Method | NA | |
| Concentration | 5.0 x 10-3 M | |
| pH | 10 | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | long twisted ribbons | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Unstable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |