Details of SAPdb ID 1668 |
Primary information | ||
---|---|---|
SAPdb_ID | 1668 | |
PMID | 29776313 | |
Year | 2018 | |
Name | arginine-glycine-aspartic acid | |
Sequence | RGD | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | conjugate | |
Conjugate Partner | cyclo(Arg-Gly-Asp-D-Tyr-Lys) (cRGDyK) | |
Technique | Fourier transform infrared (FTIR) spectroscopy | |
Solvent | EDC simultaneously with NHS | |
Method | NA | |
Concentration | 50 mM HEPES pH 7.4, 150 mM NaCl, 5% glycerol, 1 mM EDTA, 0.5% (v/v) NP-40, 0.5% (v/v) CHAPS | |
pH | 8 | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | NA | |
Type of Self-Assembly | nanoscaled coating | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Cyclic | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O |