Details of SAPdb ID 1838 |
Primary information | ||
---|---|---|
SAPdb_ID | 1838 | |
PMID | 27497073 | |
Year | 2016 | |
Name | RGD/DTX- PSL | |
Sequence | RGD | |
N-Terminal Modification | Free | |
C-Terminal Modification | DTX | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Conjugate | |
Conjugate Partner | Docetaxel | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | PBS buffer | |
Method | Dynamic light scattering (DLS) | |
Concentration | 0.01M | |
pH | 7.4 | |
Temperature | 50°C | |
Incubation Period | 50 min | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Liposomes | |
Size of Self-Assembled structure | 146.4±4.4 nm | |
Linear/Cyclic | Cyclic | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O |