Details of SAPdb ID 1661 |
Primary information | ||
---|---|---|
SAPdb_ID | 1661 | |
PMID | 29573728 | |
Year | 2018 | |
Name | Polyamidoamine (PAMAM) | |
Sequence | RGD | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | tripeptide | |
Conjugate Partner | None | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | PCL-CHIT polymer solutions | |
Method | NA | |
Concentration | 2.0 mg mL-1 | |
pH | 7.4 | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanofiber | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Cyclic | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O |