Details of SAPdb ID 1837 |
Primary information | ||
---|---|---|
SAPdb_ID | 1837 | |
PMID | 27427416 | |
Year | 2016 | |
Name | arginine-glycine-aspartic acid | |
Sequence | RGD | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | Borate buffer | |
Method | NA | |
Concentration | 0.02mol/l | |
pH | 8 | |
Temperature | Room temperature | |
Incubation Period | 24 h | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanocrystals | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Cyclic | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O |