A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1283 |
PubChem ID | 247304 |
Hormone name | 2-hydroxyestradiol |
Description | catechol estrogen; RN given refers to (17 beta)-isomer |
Synonyms | 2-Hydroxyestradiol 2-hydroxyestradiol 2-OH-Estradiol 2-hydroxy-estradiol 2-Hydroxyestradiol-17beta 2-OH-E2 2-hydroxy-17beta-estradiol |
Molecular weight | 288.38 |
Molecular formula | C18H24O3 |
IUPAC Name | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2,3,17-triol |
Canonical smiles | CC12CCC3C(C1CCC2O)CCC4=CC(=C(C=C34)O)O |
Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=C(C=C34)O)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | 2BW7   |
KEGG ID | C05301 |
HMDB ID | HMDB00338 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | P06211 Detail in HMRbase Q62986 Detail in HMRbase |
Comments | |
References | HMDB |