A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1263 |
| PubChem ID | 4901 |
| Hormone name | Pregnanediol |
| Description | |
| Synonyms | Pregnandiol Pregnane-3,20-diol Diol (6CI,7CI) Pregnane-3alpha,20alpha-diol Pregnan-3.alpha.,20-diol 5beta-Pregnane-3alpha,20alpha-diol |
| Molecular weight | 320.51 |
| Molecular formula | C21H36 |
| IUPAC Name | 17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Canonical smiles | CC(C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C)O |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB05943 |
| Melting Point | 4.89(EST) |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | O75469 Detail in HMRbase Q8SQ01 Detail in HMRbase O54915 Detail in HMRbase Q9R1A7 Detail in HMRbase Q8JIZ9 Detail in HMRbase Q8QGH6 Detail in HMRbase Q8SQ00 Detail in HMRbase Q8SQ02 Detail in HMRbase |
| Comments | !Link to Receptor is not Organism Specific |
| References | HMDB |