A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1187 |
| PubChem ID | 10591 |
| Hormone name | Taurochenodeoxycholic Acid |
| Description | A bile salt formed in the liver by conjugation of chenodeoxycholate with taurine, usually as the sodium salt. It acts as detergent to solubilize fats in the small intestine and is itself absorbed. It is used as a cholagogue and choleretic. |
| Synonyms | Taurochenodeoxycholate Chenodeoxycholyltaurine Taurine chenodeoxycholate TAUROCHENODEOXYCHOLIC ACID Ethanesulfonic acid, 2-(((3alpha,5beta,7alpha)-3,7-dihydroxy-24-oxocholan-24-yl)amino)- |
| Molecular weight | 499.7 |
| Molecular formula | C26H45NO6S |
| IUPAC Name | 2-[4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pent anoylamino]ethanesulfonic acid |
| Canonical smiles | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C |
| Isomeric smiles | CC(CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C05465 |
| HMDB ID | HMDB00951 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q3SZL0 Detail in HMRbase Q96RI1 Detail in HMRbase Q60641 Detail in HMRbase Q62735 Detail in HMRbase |
| Comments | !Link to Receptor is not Organism Specific |
| References | HMDB |