![]() |
|
|
|
|
|
|
HMRbase accession number | 1092 |
PubChem ID | 16923 |
Hormone name | Methylprednisolone Hemisuccinate |
Description | A water-soluble ester of METHYLPREDNISOLONE used for cardiac, allergic, and hypoxic emergencies. |
Synonyms | Solumedrol Methylprednisolone Hemisuccinate Urbason-Soluble A-Methapred Solu-Medrol Methylprednisolone succinate |
Molecular weight | 474.54 |
Molecular formula | C26H34O8 |
IUPAC Name | 4-[2-[(6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy] -4-oxobutanoic acid |
Canonical smiles | CC1CC2C3CCC(C3(CC(C2C4(C1=CC(=O)C=C4)C)O)C)(C(=O)COC(=O)CCC(=O)O)O |
Isomeric smiles | C[C@H]1C[C@H]2[C@@H]3CC[C@@]([C@]3(C[C@@H]([C@@H]2[C@@]4(C1=CC(=O)C=C4)C)O)C)(C(=O)COC(=O)CCC(=O)O)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | D05000   |
HMDB ID | N/A |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | DB00959 |
Drugpedia | wiki |
Receptor | P04150 Detail in HMRbase |
Comments | |
References | Pubchem |