A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1041 |
| PubChem ID | 6166 |
| Hormone name | Desoxycorticosterone |
| Description | 21-Hydroxypregn-4-ene-3,20-dione. Desoxycorticosterone acetate (DOCA) is used as replacement therapy in ADDISON DISEASE. |
| Synonyms | Desoxycortone Desoxycorticosterone Cortexone Desossicortone Desoxicortonum Deoxycortone 11-Deoxycorticosterone 21-Hydroxyprogesterone Deoxycorticosterone Desoxycorticosteronum |
| Molecular weight | 330.46 |
| Molecular formula | C21H30O3 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC12CCC3C(C1CCC2C(=O)CO)CCC4=CC(=O)CCC34C |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)CO)CCC4=CC(=O)CC[C@]34C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1Y9R 2AA7 2Q3Y |
| KEGG ID | C03205 D07792 |
| HMDB ID | HMDB00016 |
| Melting Point | 141.5(EXP) |
| Log P | 2.88(EXP) |
| Water Solubility | 59.5(EXP) at 37C |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P08235 Detail in HMRbase |
| Comments | |
| References | Pubchem,HMDB |