A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1021 |
| PubChem ID | 9782 |
| Hormone name | Betamethasone |
| Description | A glucocorticoid given orally, parenterally, by local injection, by inhalation, or applied topically in the management of various disorders in which corticosteroids are indicated. Its lack of mineralocorticoid properties makes betamethasone particularly suitable for treating cerebral edema and congenital adrenal hyperplasia. (From Martindale, The Extra Pharmacopoeia, 30th ed, p724) |
| Synonyms | betamethasone Rinderon Celestone Betadexamethasone Betafluorene Betamamallet Betamethazone Flubenisolone Betacorlan Betacortril |
| Molecular weight | 392.46 |
| Molecular formula | C22H29FO5 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-o ne |
| Canonical smiles | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C |
| Isomeric smiles | C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D00244 |
| HMDB ID | N/A |
| Melting Point | 232(EXP) |
| Log P | 1.94(EXP) |
| Water Solubility | 66.5(EXP) at 25C |
| DrugBank ID | DB00443 |
| Drugpedia | wiki |
| Receptor | P04150 Detail in HMRbase |
| Comments | |
| References | Pubchem |