A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1010 |
| PubChem ID | 5839 |
| Hormone name | Aldosterone |
| Description | A hormone secreted by the ADRENAL CORTEX that regulates electrolyte and water balance by increasing the renal retention of sodium and the excretion of potassium. |
| Synonyms | ALDOSTERONE Electrocortin Aldocortin Elektrocortin Aldocorten Aldocortene d-Aldosterone Reichstein X (+)-Aldosterone 18-Oxocorticosterone |
| Molecular weight | 360.44 |
| Molecular formula | C21H28O5 |
| IUPAC Name | (8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-13-carbaldeh yde |
| Canonical smiles | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C=O)O |
| Isomeric smiles | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@H]4C(=O)CO)C=O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C01780 |
| HMDB ID | HMDB00037 |
| Melting Point | 166.5(EXP) |
| Log P | 1.08(EXP) |
| Water Solubility | 51.2(EXP) at 37C |
| DrugBank ID | DB04630 |
| Drugpedia | wiki |
| Receptor | P08235 Detail in HMRbase |
| Comments | !Link to Receptor is not Organism Specific |
| References | Pubchem,HMDB |