A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1368 |
| PubChem ID | 5280497 |
| Hormone name | Thromboxane A2 |
| Description | An unstable intermediate between the prostaglandin endoperoxides and thromboxane B2. The compound has a bicyclic oxaneoxetane structure. It is a potent inducer of platelet aggregation and causes vasoconstriction. It is the principal component of rabbit aorta contracting substance (RCS). |
| Synonyms | Thromboxane A2 TXA2 TXA-2 9S,11S-epoxy,15S-hydroxy-thromboxa-5Z,13E-dien-1-oic acid |
| Molecular weight | 352.47 |
| Molecular formula | C20H32O5 |
| IUPAC Name | (Z)-7-[(1S,2S,3R,5S)-3-[(E,3S)-3-hydroxyoct-1-enyl]-4,7-dioxabicyclo[3.1.1]heptan-2-yl]hept-5-enoic acid |
| Canonical smiles | CCCCCC(C=CC1C(C2CC(O2)O1)CC=CCCCC(=O)O)O |
| Isomeric smiles | CCCCC[C@@H](C=C[C@@H]1[C@H]([C@@H]2C[C@@H](O2)O1)CC=C/CCCC(=O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C02198 |
| HMDB ID | HMDB01452 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P21731 Detail in HMRbase |
| Comments | |
| References | Endonet |