A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1367 |
| PubChem ID | 5280363 |
| Hormone name | prostaglandin F2alpha |
| Description | A naturally occurring prostaglandin that has oxytocic, luteolytic, and abortifacient activities. Due to its vasocontractile properties, the compound has a variety of other biological actions. |
| Synonyms | Dinoprost amoglandin cyclosin panacelan Protamodin Enzaprost Enzaprost F Cerviprost PGF2alpha prostaglandin F2alpha |
| Molecular weight | 354.48 |
| Molecular formula | C20H34O5 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
| Canonical smiles | CCCCCC(C=CC1C(CC(C1CC=CCCCC(=O)O)O)O)O |
| Isomeric smiles | CCCCC[C@@H](C=C[C@H]1[C@@H](C[C@@H]([C@@H]1CC=C/CCCC(=O)O)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C00639 D00081 |
| HMDB ID | HMDB01139 |
| Melting Point | 30(EXP) |
| Log P | 4.39(EXP) |
| Water Solubility | 2.58(EST) |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P43088 Detail in HMRbase |
| Comments | |
| References | Endonet |