A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1362 |
| PubChem ID | 5282411 |
| Hormone name | Prostacyclin |
| Description | A prostaglandin that is a powerful vasodilator and inhibits platelet aggregation. It is biosynthesized enzymatically from PROSTAGLANDIN ENDOPEROXIDES in human vascular tissue. The sodium salt has been also used to treat primary pulmonary hypertension (HYPERTENSION, PULMONARY). |
| Synonyms | epoprostenol prostacyclin Vasocyclin Flolan Prostaglandin X Prostacyclin I2 prostaglandin I2 PGI2 |
| Molecular weight | 352.47 |
| Molecular formula | C20H32O5 |
| IUPAC Name | (5Z)-5-[(3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[d]furan-2-ylidene]pentanoic acid |
| Canonical smiles | CCCCCC(C=CC1C(CC2C1CC(=CCCCC(=O)O)O2)O)O |
| Isomeric smiles | CCCCC[C@@H](C=C[C@H]1[C@@H](C[C@H]2[C@@H]1C/C(=C/CCCC(=O)O)/O2)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C01312 D00106 |
| HMDB ID | HMDB01335 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | DB01240 |
| Drugpedia | wiki |
| Receptor | P43119 Detail in HMRbase |
| Comments | |
| References | Endonet |