A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1361 |
| PubChem ID | 5283157 |
| Hormone name | 20-Hete |
| Description | stimulator of renal sodium, potassium atpase; RN given is for the (all-Z) isomer |
| Synonyms | 20-Hete 20-Hydroxyeicosatetraenoic acid 20-Hydroxy arachidonic acid 20-Hydroxyarachidonic acid 20-Hydroxyicosatetraenoic acid |
| Molecular weight | 320.47 |
| Molecular formula | C20H32O3 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoic acid |
| Canonical smiles | C(CCC=CCC=CCC=CCC=CCCCC(=O)O)CCO |
| Isomeric smiles | C(CCC=C/CC=C/CC=C/CC=C/CCCC(=O)O)CCO
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14748 |
| HMDB ID | HMDB05998 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Endonet |