A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1341 |
| PubChem ID | 28204 |
| Hormone name | Calusterone |
| Description | was MH 1975-92 (see under METHYLTESTOSTERONE 1975-90); use METHYLTESTOSTERONE to search CALUSTERONE 1975-92; RN given refers to the (7beta,17beta)-isomer |
| Synonyms | Methosarb CALUSTERONE Dimethyltestosterone Calusteron Calusteronum Calusterona 7beta,17-Dimethyltestosterone 7-beta,17-Dimethyltestosterone |
| Molecular weight | 316.48 |
| Molecular formula | C21H32O2 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S,17S)-17-hydroxy-7,10,13,17-tetramethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC1CC2=CC(=O)CCC2(C3C1C4CCC(C4(CC3)C)(C)O)C |
| Isomeric smiles | C[C@H]1CC2=CC(=O)CC[C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@]([C@]4(CC3)C)(C)O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D03338 |
| HMDB ID | HMDB04627 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |