A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1338 |
| PubChem ID | 220502 |
| Hormone name | 11b-Hydroxyprogesterone |
| Description | |
| Synonyms | 11beta-Hydroxyprogesterone 11.alpha.-Hydroxyprogesterone Progesterone, 11.alpha.-hydroxy- Pregn-4-ene-3,20-dione, 11.alpha.-hydroxy- Pregn-4-ene-3,20-dione, 11-hydroxy-, (11.alpha.)- Pregn-4-ene-3,20-dione, 11.beta.-hydroxy- |
| Molecular weight | 330.46 |
| Molecular formula | C20H28O4 |
| IUPAC Name | 17-acetyl-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC(=O)C1CCC2C1(CC(C3C2CCC4=CC(=O)CCC34C)O)C |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C05498 |
| HMDB ID | HMDB04031 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |