A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1337 |
| PubChem ID | 6290 |
| Hormone name | 11-Dehydrocorticosterone |
| Description | |
| Synonyms | 17-Deoxycortisone Dehydrocorticosterone Kendall's compound A Corticosterone, dehydro- 11-Dehydrocorticosteron Cortisone, 17-deoxy- 11-dehydrocorticosterone Corticosterone, 11-dehydro- 11-Oxo-11-deoxycorticosterone |
| Molecular weight | 344.44 |
| Molecular formula | C21H28O4 |
| IUPAC Name | 17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
| Canonical smiles | CC12CCC(=O)C=C1CCC3C2C(=O)CC4(C3CCC4C(=O)CO)C |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C05490 |
| HMDB ID | HMDB04029 |
| Melting Point | 183.5(EXP) |
| Log P | 1.77(EST) |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |