A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1318 |
| PubChem ID | 150890 |
| Hormone name | 16-Oxoandrostenediol |
| Description | synthesized by hepatic microsomes from previable and anencephalic human fetuses; abundant steroid of umbilical cord blood and the physiologic precursor for 16-ketoestradiol-17 beta; major urinary estrogen of human pregnancy; structure |
| Synonyms | 16-Oxoandrostenediol 3 beta,17 beta-dihydroxyandrost-5-en-16-one 16-Ketoandrostenediol Androst-5-en-16-one, 3,17-dihydroxy-, (3.beta.,17.beta.)- Androst-5-en-16-one, 3,17-dihydroxy-, (3beta,17beta)- (9CI) |
| Molecular weight | 304.42 |
| Molecular formula | C19H28O3 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| Canonical smiles | CC12CCC(CC1=CCC3C2CCC4(C3CC(=O)C4O)C)O |
| Isomeric smiles | C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC(=O)[C@@H]4O)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB00322 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |