A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1303 |
PubChem ID | 6449983 |
Hormone name | Cholesteryl 9-hexadecenoate |
Description | RN given refers to (Z)-isomer |
Synonyms | Cholesteryl 9-palmitoleate cholesteryl 9-hexadecenoate Cholesteryl 9-hexadecenoate Cholesteryl 9-palmitelaidate Cholesteryl cis-9-hexadecenoate Cholest-5-en-3-ol (3beta)-, 9-hexadecenoate, (Z)- |
Molecular weight | 623.05 |
Molecular formula | C43H74O2 |
IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-he xadec-9-enoate |
Canonical smiles | CCCCCCC=CCCCCCCCC(=O)OC1CCC2(C3CCC4(C(C3CC=C2C1)CCC4C(C)CCCC(C)C)C)C |
Isomeric smiles | CCCCCCC=CCCCCCCCC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CC[C@@H]4[C@H](C)CCCC(C)C)C)C
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | C02530 |
HMDB ID | HMDB00658 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | HMDB |