A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1299 |
PubChem ID | 14274976 |
Hormone name | 20:3 Cholesteryl ester |
Description | |
Synonyms | 20:3 Cholesteryl ester cholest-5-en-3beta-yl (8Z,11Z,14Z-eicosatrienoate) |
Molecular weight | 675.12 |
Molecular formula | C47H78O2 |
IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl](8Z,11Z ,14Z)-icosa-8,11,14-trienoate |
Canonical smiles | CCCCCC=CCC=CCC=CCCCCCCC(=O)OC1CCC2(C3CCC4(C(C3CC=C2C1)CCC4C(C)CCCC(C)C)C)C |
Isomeric smiles | CCCCCC=C/CC=C/CC=C/CCCCCCC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CC[C@@H]4[C@H](C)CCCC(C)C)C)C |
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | C02530 |
HMDB ID | HMDB06736 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | HMDB |