| HMRbase accession number | 1292 |
| PubChem ID | 6437855 |
| Hormone name | 1,25-dihydroxyergocalciferol |
| Description | RN given refers to (3beta,5Z,7E,22E)-isomer |
| Synonyms | 1,25-Dihydroxyvitamin D2 1,25-Dihydroxyergocalciferol 1alpha,25-Dihydroxyvitamin D2 1,25-(OH)2D2 9,10-Segoergosta-5,7,10(19),22-tetraene-1,3,25-triol, (3beta,5Z,7E,22E)- |
| Molecular weight | 428.65 |
| Molecular formula | C28H44O3 |
| IUPAC Name | (1R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methyl
idenecyclohexane-1,3-diol |
| Canonical smiles | CC(C=CC(C)C(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CC(C3=C)O)O)C |
| Isomeric smiles | C[C@H](C=C[C@H](C)C(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](CC(C3=C)O)O)C
|
| Structure |
| PDB file |
| SDF file |
| MOL file |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB06225 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |
A database of hormones and their receptors