A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1288 |
| PubChem ID | 92730 |
| Hormone name | 11alpha-Hydroxyprogesterone |
| Description | |
| Synonyms | 11alpha-Hydroxyprogesterone Progesterone, 11alpha-hydroxy- 4-Pregnen-11alpha-ol-3,20-dione |
| Molecular weight | 330.46 |
| Molecular formula | C21H30O3 |
| IUPAC Name | (8S,9S,10R,11R,13S,14S,17S)-17-acetyl-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC(=O)C1CCC2C1(CC(C3C2CCC4=CC(=O)CCC34C)O)C |
| Isomeric smiles | CC(=O)[C@H]1CC[C@@H]2[C@@]1(C[C@H]([C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C03747 |
| HMDB ID | HMDB00920 |
| Melting Point | 2.13(EST) |
| Log P | 50(EXP) |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |