A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1286 |
| PubChem ID | 227041 |
| Hormone name | Cholesteryl linoleate |
| Description | RN given refers to (Z,Z)-isomer |
| Synonyms | Cholesterol linolate Cholesterol, linoleate Cholest-5-en-3-ol (3.beta.)-, 9,12-octadecadienoate, (Z,Z)- |
| Molecular weight | 649.08 |
| Molecular formula | C45H76O2 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadeca-9,12-dienoate |
| Canonical smiles | CCCCCC=CCC=CCCCCCCCC(=O)OC1CCC2(C3CCC4(C(C3CC=C2C1)CCC4C(C)CCCC(C)C)C)C |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C15441 |
| HMDB ID | HMDB00610 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |