A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1268 |
| PubChem ID | 101850 |
| Hormone name | 11-ketoetiocholanolone |
| Description | RN given refers to (3alpha,5beta)-isomer |
| Synonyms | 11-Ketoetiocholanolone Etiocholanol-11-one 11-Oxoetiocholanolone 11-Oxoaetiocholanolone Ba 2684 5beta-Androstan-3alpha-ol-11,17-dione 3alpha-Hydroxy-5beta-androstane-11,17-dione 3alpha-Hydroxy-11,17-dioxo-5beta-androstane |
| Molecular weight | 304.42 |
| Molecular formula | C19H28O3 |
| IUPAC Name | (3R,5R,8S,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-11,17-dione |
| Canonical smiles | CC12CCC(CC1CCC3C2C(=O)CC4(C3CCC4=O)C)O |
| Isomeric smiles | C[C@]12CC[C@H](C[C@H]1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CCC4=O)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14552 |
| HMDB ID | HMDB06031 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |