A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1251 |
| PubChem ID | 13472 |
| Hormone name | 1,4-androstadiene-3,17-dione |
| Description | structure |
| Synonyms | Boldione 1,4-androstadiene-3,17-dione Androstadienedione 1-Dehydroandrostenedione androsta-1,4-diene-3,17-dione |
| Molecular weight | 284.39 |
| Molecular formula | C19H24O2 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
| Canonical smiles | CC12CCC3C(C1CCC2=O)CCC4=CC(=O)C=CC34C |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=CC(=O)C=C[C@]34C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1EUP 1H62 1XF0 |
| KEGG ID | N/A |
| HMDB ID | HMDB03422 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |