| HMRbase accession number | 1249 |
| PubChem ID | N/A |
| Hormone name | (3a,5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl-b-D-Glucopyranosiduronic acid |
| Description | (3a,5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl-b-D-Glucopyranosiduronic acid is a natural human metabolite of Taurolithocholic acid generated in the liver by UDP glucuonyltransferase.Glucuronidation is used to assist in the excretion of toxic substances, drugs or other substances that cannot be used as an energy source. Glucuronic acid is attached via a glycosidic bond to the substance, and the resulting glucuronide, which has a much higher water solubility than the original substance, is eventually excreted by the kidneys. |
| Synonyms | (3a,5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl-b-D-Glucopyranosiduronate#Taurolithocholic acid 3-glucuronide#(3a,5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl-beta-delta-Glucopyranosiduronate |
| Molecular weight | 659.83 |
| Molecular formula | C32H53NO11S |
| IUPAC Name | (3a,5b)-24-oxo-24-[(2-sulfoethyl)amino]cholan-3-yl b-D-glucopyranosiduronic acid
|
| Canonical smiles | CC(CCC(=O)NCCS(O)(=O)=O)C1CCC2C3CCC4CC(CCC4(C)C3CCC12C)OC1OC(C(O)C(O)C1O)C(O)=O |
| Isomeric smiles | C[C@H](CCC(=O)NCCS(O)(=O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CC(CC[C@]4(C)[C@H]3CC[C@]12C)O[C@@H]1O[C@@H]([C@@H](
O)[C@H](O)[C@H]1O)C(O)=O
|
| Structure |
| PDB file |
| SDF file |
| MOL file |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB02429 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |
A database of hormones and their receptors