A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1227 |
| PubChem ID | 66417 |
| Hormone name | 16-ketoestradiol |
| Description | RN given refers to (17beta)-isomer |
| Synonyms | 16-Ketoestradiol 16-Oxoestradiol 16-ketoestradiol 16-Oxo-17beta-estradiol Estra-1,3,5(10)-triene-3beta,17beta-diol-16-one (17beta)-3,17-dihydroxyestra-1(10),2,4-trien-16-one |
| Molecular weight | 286.37 |
| Molecular formula | C18H22O3 |
| IUPAC Name | (8R,9S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-16-one |
| Canonical smiles | CC12CCC3C(C1CC(=O)C2O)CCC4=C3C=CC(=C4)O |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC(=O)[C@@H]2O)CCC4=C3C=CC(=C4)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14383 |
| HMDB ID | HMDB00406 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |