A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1209 |
| PubChem ID | 107835 |
| Hormone name | 17,20-dihydroxy-4-pregnen-3-one |
| Description | a maturation-inducing hormone; possible role in regulation of testosterone synthesis by rat and rabbit testis; see also record for (20R)-isomer: 1662-06-2; RN given refers to all (alpha)-isomer; structure |
| Synonyms | 17alpha,20beta-DP 17a,20a-DHP 17,10beta-P 17,20beta-P 17,20-Dihydroxy-4-pregnen-3-one 17,20beta-Dihydroxy-4-pregnen-3-one 17,21-Dihydroxypregn-4-en-3-one 17alpha,20alpha-Dihydroxyprogesterone |
| Molecular weight | 332.48 |
| Molecular formula | C21H32O3 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-17-(2-hydroxyethyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC12CCC(=O)C=C1CCC3C2CCC4(C3CCC4(CCO)O)C |
| Isomeric smiles | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@]4(CCO)O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB03851 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |