| HMRbase accession number | 1203 |
| PubChem ID | N/A |
| Hormone name | (3a,5b,7a,12a)-24-[(carboxymethyl)amino]-1,12-dihydroxy-24-oxocholan-3-yl-b-D-Glucopyranosiduronic a |
| Description | b-D-GlucopyranosIduronic acid, (3a,5b,7a,12a)-24-[(carboxymethyl)amino]-1,12-dihydroxy-24-oxocholan-3-yl is found in the urine of leprosy patients. It is red in color similar to clofazimine. It is considered more polar than the parent drug. It is formed by hydrolytic deamination followed by glucuronidation.(PMID: 6120809) |
| Synonyms | Glycocholic acid 3-glucuronide |
| Molecular weight | 641.75 |
| Molecular formula | C32H51NO12 |
| IUPAC Name | (3a,5b,7a,12a)-24-[(carboxymethyl)amino]-1,12-dihydroxy-24-oxocholan-3-yl b-D-glucopyranosiduronic acid
|
| Canonical smiles | CC(CCC(=O)NCC(O)=O)C1CCC2C3C(O)CC4CC(CCC4(C)C3CC(O)C12C)OC1OC(C(O)C(O)C1O)C(O)=O |
| Isomeric smiles | C[C@H](CCC(=O)NCC(O)=O)C1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@@H](CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C)O[C@@H]1O[C@@
H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O
|
| Structure |
| PDB file |
| SDF file |
| MOL file |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB02472 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |
A database of hormones and their receptors