| HMRbase accession number | 1175 |
| PubChem ID | N/A |
| Hormone name | 16,17-Epiestriol |
| Description | A hydroxylated metabolite of estradiol or estrone that has a hydroxyl group at C3-beta, 16-, and 17- position. Estriol is a major urinary estrogen. During pregnancy, large amount of estriol is produced by the placenta. Isomers with inversion of the hydroxyl group or groups are called epiestriol (16-beta, 17-alpha). |
| Synonyms | 16,17-Epiestriol#16,17-epi-Estriol#16b,17a-Estriol#16b-Hydroxy-17a-estradiol#Estra-1,3,5(10)-triene-3,16b,17a-triol#trans-Estriol |
| Molecular weight | 288.38 |
| Molecular formula | C18H24O3 |
| IUPAC Name | (16b,17a)-Estra-1,3,5(10)-triene-3,16,17-triol
|
| Canonical smiles | CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CC(O)C2O |
| Isomeric smiles | C[C@]12CC[C@H]3[C@@H](CCC4=C3C=CC(O)=C4)[C@@H]1C[C@H](O)[C@H]2O
|
| Structure |
| PDB file |
| SDF file |
| MOL file |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB00431 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |
A database of hormones and their receptors