A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1171 |
| PubChem ID | 168847 |
| Hormone name | 16-Hydroxydehydroepiandrosterone sulfate |
| Description | RN given refers to cpd with unspecified sulfate ester linkage locant and (3 beta,16 beta)-isomer |
| Synonyms | 16beta-OH-Dhea sulfate 16 alpha-OH-DHEA-sulfate 16-Hydroxydehydroepiandrosterone sulfate 16beta-Hydroxydehydroepiandrosterone sulfate Androst-5-en-17-one, 3,16-dihydroxy-, mono(hydrogen sulfate), (3beta,16beta)- |
| Molecular weight | 384.49 |
| Molecular formula | C19H28O6S |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,16S)-3-hydroxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl] hydrogensulfate |
| Canonical smiles | CC12CCC(CC1=CCC3C2CCC4(C3CC(C4=O)OS(=O)(=O)O)C)O |
| Isomeric smiles | C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3C[C@@H](C4=O)OS(=O)(=O)O)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB00386 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |