A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1165 |
| PubChem ID | 102030 |
| Hormone name | 16-hydroxydehydroepiandrosterone |
| Description | RN refers to (3beta,16alpha)-isomer |
| Synonyms | 16alpha-Hydroxydehydroepiandrosterone 16-Hydroxydehydroepiandrosterone 5-Androstene-3beta,16alpha-diol-17-one 3beta,16alpha-Dihydroxyandrost-5-en-17-one 16alpha-Hydroxydehydroepiandrosterone sulfate 3beta,16beta-Dihydroxyandrost-5-en-17-one |
| Molecular weight | 304.42 |
| Molecular formula | C19H28O3 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,16R)-3,16-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| Canonical smiles | CC12CCC(CC1=CCC3C2CCC4(C3CC(C4=O)O)C)O |
| Isomeric smiles | C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3C[C@H](C4=O)O)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C05139 |
| HMDB ID | HMDB00352 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |