A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1162 |
PubChem ID | 114852 |
Hormone name | 16-hydroxyestrone |
Description | has implications in estrogen physiology and pathophysiology; RN given refers to parent cpd; structure in Negwer, 5th ed, #3670 |
Synonyms | 16-Hydroxyestrone 16beta-Hydroxyestrone 16alpha-Hydroxyestrone 3,16-Dihydroxyestra-1,3,5(10)-trien-17-one Estra-1,3,5(10)-trien-17-one, 3,16-dihydroxy- |
Molecular weight | 286.37 |
Molecular formula | C18H22O3 |
IUPAC Name | (8R,9S,13S,14S)-3,16-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
Canonical smiles | CC12CCC3C(C1CC(C2=O)O)CCC4=C3C=CC(=C4)O |
Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC(C2=O)O)CCC4=C3C=CC(=C4)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | N/A |
HMDB ID | HMDB00313 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | HMDB |