A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1110 |
| PubChem ID | 22069 |
| Hormone name | Reverse T3 |
| Description | A metabolite of THYROXINE, formed by the peripheral enzymatic monodeiodination of T4 at the 5 position of the inner ring of the iodothyronine nucleus. |
| Synonyms | Reverse T3 Triiodothyronine, reverse Triiodothyronine, Reverse 3,3',5'-Triiodothyronine Triiodothyronine, Reverse REVERSE TRIIODOTHYRONINE Triiodothyronine, Reverse 3,3',5'-Triiodo-L-thyronine T0281_SIGMA 3,5,3'-Triiodo-L-thyronine O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine |
| Molecular weight | 650.97 |
| Molecular formula | C15H12I3NO4 |
| IUPAC Name | 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenyl]propanoic acid |
| Canonical smiles | C1=CC(=C(C=C1CC(C(=O)O)N)I)OC2=CC(=C(C(=C2)I)O)I |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07639 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |