A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1056 |
| PubChem ID | 244809 |
| Hormone name | Epimestrol |
| Description | A synthetic steroid with estrogenic activity. |
| Synonyms | Stimovul Epimestrol 3-Methoxy-17-epiestriol 3-Methoxyestra-1,3,5(10)-triene-16alpha,17alpha-diol |
| Molecular weight | 302.41 |
| Molecular formula | C19H26O3 |
| IUPAC Name | (8R,9S,13S,14S,16R,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol |
| Canonical smiles | CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)OC |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@H]2O)O)CCC4=C3C=CC(=C4)OC
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14593 D04021 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |